C9H15ClN2S — CID 130961429
1-(3-chlorothiophen-2-yl)-3-methylbutane-1,2-diamine (PubChem CID 130961429) has the molecular formula C9H15ClN2S and a molecular weight of 218.75 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-3-methylbutane-1,2-diamine.
| Compound Name | 1-(3-chlorothiophen-2-yl)-3-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 130961429 |
| Molecular Formula | C9H15ClN2S |
| Molecular Weight | 218.75 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-3-methylbutane-1,2-diamine |
| SMILES | CC(C)C(N)C(N)c1sccc1Cl |
| InChI | InChI=1S/C9H15ClN2S/c1-5(2)7(11)8(12)9-6(10)3-4-13-9/h3-5,7-8H,11-12H2,1-2H3 |
| InChIKey | WTFAKQJRENPIII-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.75 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |