About 1-(3-chlorothiophen-2-yl)-2-methoxy-N,3-dimethylbutan-1-amine
1-(3-chlorothiophen-2-yl)-2-methoxy-N,3-dimethylbutan-1-amine (PubChem CID 107360216) has the molecular formula C11H18ClNOS
and a molecular weight of 247.79 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-2-methoxy-N,3-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 1-(3-chlorothiophen-2-yl)-2-methoxy-N,3-dimethylbutan-1-amine |
| PubChem CID | 107360216 |
| Molecular Formula | C11H18ClNOS |
| Molecular Weight | 247.79 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-2-methoxy-N,3-dimethylbutan-1-amine |
| SMILES | CNC(c1sccc1Cl)C(OC)C(C)C |
| InChI | InChI=1S/C11H18ClNOS/c1-7(2)10(14-4)9(13-3)11-8(12)5-6-15-11/h5-7,9-10,13H,1-4H3 |
| InChIKey | YITISCOFLIEFMB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.79 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-chlorothiophen-2-yl)-2-methoxy-N,3-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chlorothiophen-2-yl)-2-methoxy-N,3-dimethylbutan-1-amine?
The IUPAC name of 1-(3-chlorothiophen-2-yl)-2-methoxy-N,3-dimethylbutan-1-amine (CID 107360216) is 1-(3-chlorothiophen-2-yl)-2-methoxy-N,3-dimethylbutan-1-amine.
What is the SMILES notation for 1-(3-chlorothiophen-2-yl)-2-methoxy-N,3-dimethylbutan-1-amine?
The canonical SMILES for 1-(3-chlorothiophen-2-yl)-2-methoxy-N,3-dimethylbutan-1-amine is CNC(c1sccc1Cl)C(OC)C(C)C.
What is the InChIKey of 1-(3-chlorothiophen-2-yl)-2-methoxy-N,3-dimethylbutan-1-amine?
The InChIKey is YITISCOFLIEFMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18ClNOS/c1-7(2)10(14-4)9(13-3)11-8(12)5-6-15-11/h5-7,9-10,13H,1-4H3.
What are the key properties of 1-(3-chlorothiophen-2-yl)-2-methoxy-N,3-dimethylbutan-1-amine?
1-(3-chlorothiophen-2-yl)-2-methoxy-N,3-dimethylbutan-1-amine has a molecular weight of 247.79 g/mol, XLogP of 3.33, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chlorothiophen-2-yl)-2-methoxy-N,3-dimethylbutan-1-amine is sourced from PubChem (CID 107360216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).