C12H20ClNS — CID 105028560
1-(3-chlorothiophen-2-yl)-N,5-dimethylhexan-1-amine (PubChem CID 105028560) has the molecular formula C12H20ClNS and a molecular weight of 245.82 g/mol. Its IUPAC name is 1-(3-chlorothiophen-2-yl)-N,5-dimethylhexan-1-amine.
| Compound Name | 1-(3-chlorothiophen-2-yl)-N,5-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 105028560 |
| Molecular Formula | C12H20ClNS |
| Molecular Weight | 245.82 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 1-(3-chlorothiophen-2-yl)-N,5-dimethylhexan-1-amine |
| SMILES | CNC(CCCC(C)C)c1sccc1Cl |
| InChI | InChI=1S/C12H20ClNS/c1-9(2)5-4-6-11(14-3)12-10(13)7-8-15-12/h7-9,11,14H,4-6H2,1-3H3 |
| InChIKey | JARDBDYGRYYNLD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.82 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |