C16H29NOS — CID 116725711
4-ethoxy-N-ethyl-5,5-dimethyl-1-thiophen-2-ylhexan-3-amine (PubChem CID 116725711) has the molecular formula C16H29NOS and a molecular weight of 283.48 g/mol. Its IUPAC name is 4-ethoxy-N-ethyl-5,5-dimethyl-1-thiophen-2-ylhexan-3-amine.
| Compound Name | 4-ethoxy-N-ethyl-5,5-dimethyl-1-thiophen-2-ylhexan-3-amine |
|---|---|
| PubChem CID | 116725711 |
| Molecular Formula | C16H29NOS |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | 4-ethoxy-N-ethyl-5,5-dimethyl-1-thiophen-2-ylhexan-3-amine |
| SMILES | CCNC(CCc1cccs1)C(OCC)C(C)(C)C |
| InChI | InChI=1S/C16H29NOS/c1-6-17-14(11-10-13-9-8-12-19-13)15(18-7-2)16(3,4)5/h8-9,12,14-15,17H,6-7,10-11H2,1-5H3 |
| InChIKey | YEKKBHQJTIAWRV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |