C13H23NO2S — CID 79493483
1,1-dimethoxy-N-propyl-4-thiophen-2-ylbutan-2-amine (PubChem CID 79493483) has the molecular formula C13H23NO2S and a molecular weight of 257.40 g/mol. Its IUPAC name is 1,1-dimethoxy-N-propyl-4-thiophen-2-ylbutan-2-amine.
| Compound Name | 1,1-dimethoxy-N-propyl-4-thiophen-2-ylbutan-2-amine |
|---|---|
| PubChem CID | 79493483 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1,1-dimethoxy-N-propyl-4-thiophen-2-ylbutan-2-amine |
| SMILES | CCCNC(CCc1cccs1)C(OC)OC |
| InChI | InChI=1S/C13H23NO2S/c1-4-9-14-12(13(15-2)16-3)8-7-11-6-5-10-17-11/h5-6,10,12-14H,4,7-9H2,1-3H3 |
| InChIKey | PVNUIEOYMUCBCU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|