C17H31NS — CID 115860884
N-propyl-1-thiophen-2-yldecan-3-amine (PubChem CID 115860884) has the molecular formula C17H31NS and a molecular weight of 281.51 g/mol. Its IUPAC name is N-propyl-1-thiophen-2-yldecan-3-amine.
| Compound Name | N-propyl-1-thiophen-2-yldecan-3-amine |
|---|---|
| PubChem CID | 115860884 |
| Molecular Formula | C17H31NS |
| Molecular Weight | 281.51 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | N-propyl-1-thiophen-2-yldecan-3-amine |
| SMILES | CCCCCCCC(CCc1cccs1)NCCC |
| InChI | InChI=1S/C17H31NS/c1-3-5-6-7-8-10-16(18-14-4-2)12-13-17-11-9-15-19-17/h9,11,15-16,18H,3-8,10,12-14H2,1-2H3 |
| InChIKey | RDULSPKDWFMBLC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|