C17H31NS — CID 105137843
6-methyl-N-propyl-1-thiophen-2-ylnonan-4-amine (PubChem CID 105137843) has the molecular formula C17H31NS and a molecular weight of 281.51 g/mol. Its IUPAC name is 6-methyl-N-propyl-1-thiophen-2-ylnonan-4-amine.
| Compound Name | 6-methyl-N-propyl-1-thiophen-2-ylnonan-4-amine |
|---|---|
| PubChem CID | 105137843 |
| Molecular Formula | C17H31NS |
| Molecular Weight | 281.51 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | 6-methyl-N-propyl-1-thiophen-2-ylnonan-4-amine |
| SMILES | CCCNC(CCCc1cccs1)CC(C)CCC |
| InChI | InChI=1S/C17H31NS/c1-4-8-15(3)14-16(18-12-5-2)9-6-10-17-11-7-13-19-17/h7,11,13,15-16,18H,4-6,8-10,12,14H2,1-3H3 |
| InChIKey | IBPBGNVGNZSSMQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |