C19H31NS — CID 105167824
1-(2-bicyclo[2.2.1]heptanyl)-N-propyl-5-thiophen-2-ylpentan-2-amine (PubChem CID 105167824) has the molecular formula C19H31NS and a molecular weight of 305.53 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-N-propyl-5-thiophen-2-ylpentan-2-amine.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-N-propyl-5-thiophen-2-ylpentan-2-amine |
|---|---|
| PubChem CID | 105167824 |
| Molecular Formula | C19H31NS |
| Molecular Weight | 305.53 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-N-propyl-5-thiophen-2-ylpentan-2-amine |
| SMILES | CCCNC(CCCc1cccs1)CC1CC2CCC1C2 |
| InChI | InChI=1S/C19H31NS/c1-2-10-20-18(5-3-6-19-7-4-11-21-19)14-17-13-15-8-9-16(17)12-15/h4,7,11,15-18,20H,2-3,5-6,8-10,12-14H2,1H3 |
| InChIKey | GEEBAKSSXNUZJV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |