C9H14O2S — CID 138661529
(1R,2R)-3-methyl-1-thiophen-2-ylbutane-1,2-diol (PubChem CID 138661529) has the molecular formula C9H14O2S and a molecular weight of 186.28 g/mol. Its IUPAC name is (1R,2R)-3-methyl-1-thiophen-2-ylbutane-1,2-diol.
| Compound Name | (1R,2R)-3-methyl-1-thiophen-2-ylbutane-1,2-diol |
|---|---|
| PubChem CID | 138661529 |
| Molecular Formula | C9H14O2S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | (1R,2R)-3-methyl-1-thiophen-2-ylbutane-1,2-diol |
| SMILES | CC(C)[C@@H](O)[C@@H](O)c1cccs1 |
| InChI | InChI=1S/C9H14O2S/c1-6(2)8(10)9(11)7-4-3-5-12-7/h3-6,8-11H,1-2H3/t8-,9+/m1/s1 |
| InChIKey | FWSJIGUYKWFDDI-BDAKNGLRSA-N |
| XLogP | 1.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |