C9H12OS — CID 11651207
(1R,2S)-2-methyl-1-thiophen-2-ylbut-3-en-1-ol (PubChem CID 11651207) has the molecular formula C9H12OS and a molecular weight of 168.26 g/mol. Its IUPAC name is (1R,2S)-2-methyl-1-thiophen-2-ylbut-3-en-1-ol.
| Compound Name | (1R,2S)-2-methyl-1-thiophen-2-ylbut-3-en-1-ol |
|---|---|
| PubChem CID | 11651207 |
| Molecular Formula | C9H12OS |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | (1R,2S)-2-methyl-1-thiophen-2-ylbut-3-en-1-ol |
| SMILES | C=C[C@H](C)[C@@H](O)c1cccs1 |
| InChI | InChI=1S/C9H12OS/c1-3-7(2)9(10)8-5-4-6-11-8/h3-7,9-10H,1H2,2H3/t7-,9+/m0/s1 |
| InChIKey | DLAPODKQMDCYGI-IONNQARKSA-N |
| XLogP | 2.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|