C16H21NO4S — CID 11515325
(2S)-2-hydroxy-2-phenylacetic acid;(1S)-3-(methylamino)-1-thiophen-2-ylpropan-1-ol (PubChem CID 11515325) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is (2S)-2-hydroxy-2-phenylacetic acid;(1S)-3-(methylamino)-1-thiophen-2-ylpropan-1-ol.
| Compound Name | (2S)-2-hydroxy-2-phenylacetic acid;(1S)-3-(methylamino)-1-thiophen-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 11515325 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (2S)-2-hydroxy-2-phenylacetic acid;(1S)-3-(methylamino)-1-thiophen-2-ylpropan-1-ol |
| SMILES | CNCC[C@H](O)c1cccs1.O=C(O)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C8H13NOS.C8H8O3/c1-9-5-4-7(10)8-3-2-6-11-8;9-7(8(10)11)6-4-2-1-3-5-6/h2-3,6-7,9-10H,4-5H2,1H3;1-5,7,9H,(H,10,11)/t2*7-/m00/s1 |
| InChIKey | JDHCRACXYLZGJN-VGMFFHCQSA-N |
| XLogP | 2.20 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |