C8H14N2S — CID 74600564
N'-methyl-1-thiophen-2-ylpropane-1,3-diamine (PubChem CID 74600564) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is N'-methyl-1-thiophen-2-ylpropane-1,3-diamine.
| Compound Name | N'-methyl-1-thiophen-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 74600564 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | N'-methyl-1-thiophen-2-ylpropane-1,3-diamine |
| SMILES | CNCCC(N)c1cccs1 |
| InChI | InChI=1S/C8H14N2S/c1-10-5-4-7(9)8-3-2-6-11-8/h2-3,6-7,10H,4-5,9H2,1H3 |
| InChIKey | YHENKZBBQSLIHA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |