C7H12N2S — CID 115287726
N'-methyl-1-thiophen-2-ylethane-1,2-diamine (PubChem CID 115287726) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is N'-methyl-1-thiophen-2-ylethane-1,2-diamine.
| Compound Name | N'-methyl-1-thiophen-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 115287726 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | N'-methyl-1-thiophen-2-ylethane-1,2-diamine |
| SMILES | CNCC(N)c1cccs1 |
| InChI | InChI=1S/C7H12N2S/c1-9-5-6(8)7-3-2-4-10-7/h2-4,6,9H,5,8H2,1H3 |
| InChIKey | JSDQGLXRZLOAHE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |