C9H16N2OS — CID 115287823
N'-(2-methoxyethyl)-1-thiophen-2-ylethane-1,2-diamine (PubChem CID 115287823) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is N'-(2-methoxyethyl)-1-thiophen-2-ylethane-1,2-diamine.
| Compound Name | N'-(2-methoxyethyl)-1-thiophen-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 115287823 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | N'-(2-methoxyethyl)-1-thiophen-2-ylethane-1,2-diamine |
| SMILES | COCCNCC(N)c1cccs1 |
| InChI | InChI=1S/C9H16N2OS/c1-12-5-4-11-7-8(10)9-3-2-6-13-9/h2-3,6,8,11H,4-5,7,10H2,1H3 |
| InChIKey | VHDPFYAWZUSVGI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|