C18H15Cl3O4 — CID 91733502
1-O-(2,3-dimethylphenyl) 4-O-(2,4,6-trichlorophenyl) butanedioate (PubChem CID 91733502) has the molecular formula C18H15Cl3O4 and a molecular weight of 401.67 g/mol. Its IUPAC name is 1-O-(2,3-dimethylphenyl) 4-O-(2,4,6-trichlorophenyl) butanedioate.
| Compound Name | 1-O-(2,3-dimethylphenyl) 4-O-(2,4,6-trichlorophenyl) butanedioate |
|---|---|
| PubChem CID | 91733502 |
| Molecular Formula | C18H15Cl3O4 |
| Molecular Weight | 401.67 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 1-O-(2,3-dimethylphenyl) 4-O-(2,4,6-trichlorophenyl) butanedioate |
| SMILES | Cc1cccc(OC(=O)CCC(=O)Oc2c(Cl)cc(Cl)cc2Cl)c1C |
| InChI | InChI=1S/C18H15Cl3O4/c1-10-4-3-5-15(11(10)2)24-16(22)6-7-17(23)25-18-13(20)8-12(19)9-14(18)21/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | YSIQDBTTXRILSO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|