C18H15Cl3O4 — CID 91733488
1-O-(2-methylphenyl) 5-O-(2,4,6-trichlorophenyl) pentanedioate (PubChem CID 91733488) has the molecular formula C18H15Cl3O4 and a molecular weight of 401.67 g/mol. Its IUPAC name is 1-O-(2-methylphenyl) 5-O-(2,4,6-trichlorophenyl) pentanedioate.
| Compound Name | 1-O-(2-methylphenyl) 5-O-(2,4,6-trichlorophenyl) pentanedioate |
|---|---|
| PubChem CID | 91733488 |
| Molecular Formula | C18H15Cl3O4 |
| Molecular Weight | 401.67 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | 1-O-(2-methylphenyl) 5-O-(2,4,6-trichlorophenyl) pentanedioate |
| SMILES | Cc1ccccc1OC(=O)CCCC(=O)Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl3O4/c1-11-5-2-3-6-15(11)24-16(22)7-4-8-17(23)25-18-13(20)9-12(19)10-14(18)21/h2-3,5-6,9-10H,4,7-8H2,1H3 |
| InChIKey | FLYJSPDECFFSEX-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.67 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|