C18H11Cl3F4O4 — CID 91740492
1-O-[2-fluoro-3-(trifluoromethyl)phenyl] 5-O-(2,4,6-trichlorophenyl) pentanedioate (PubChem CID 91740492) has the molecular formula C18H11Cl3F4O4 and a molecular weight of 473.63 g/mol. Its IUPAC name is 1-O-[2-fluoro-3-(trifluoromethyl)phenyl] 5-O-(2,4,6-trichlorophenyl) pentanedioate.
| Compound Name | 1-O-[2-fluoro-3-(trifluoromethyl)phenyl] 5-O-(2,4,6-trichlorophenyl) pentanedioate |
|---|---|
| PubChem CID | 91740492 |
| Molecular Formula | C18H11Cl3F4O4 |
| Molecular Weight | 473.63 g/mol |
| Exact Mass | 471.97 |
| IUPAC Name | 1-O-[2-fluoro-3-(trifluoromethyl)phenyl] 5-O-(2,4,6-trichlorophenyl) pentanedioate |
| SMILES | O=C(CCCC(=O)Oc1c(Cl)cc(Cl)cc1Cl)Oc1cccc(C(F)(F)F)c1F |
| InChI | InChI=1S/C18H11Cl3F4O4/c19-9-7-11(20)17(12(21)8-9)29-15(27)6-2-5-14(26)28-13-4-1-3-10(16(13)22)18(23,24)25/h1,3-4,7-8H,2,5-6H2 |
| InChIKey | GVQIEWLTRYRNEQ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.63 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|