C23H17Cl3O5 — CID 91728163
1-O-[(3-phenoxyphenyl)methyl] 4-O-(2,4,6-trichlorophenyl) butanedioate (PubChem CID 91728163) has the molecular formula C23H17Cl3O5 and a molecular weight of 479.74 g/mol. Its IUPAC name is 1-O-[(3-phenoxyphenyl)methyl] 4-O-(2,4,6-trichlorophenyl) butanedioate.
| Compound Name | 1-O-[(3-phenoxyphenyl)methyl] 4-O-(2,4,6-trichlorophenyl) butanedioate |
|---|---|
| PubChem CID | 91728163 |
| Molecular Formula | C23H17Cl3O5 |
| Molecular Weight | 479.74 g/mol |
| Exact Mass | 478.01 |
| IUPAC Name | 1-O-[(3-phenoxyphenyl)methyl] 4-O-(2,4,6-trichlorophenyl) butanedioate |
| SMILES | O=C(CCC(=O)Oc1c(Cl)cc(Cl)cc1Cl)OCc1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C23H17Cl3O5/c24-16-12-19(25)23(20(26)13-16)31-22(28)10-9-21(27)29-14-15-5-4-8-18(11-15)30-17-6-2-1-3-7-17/h1-8,11-13H,9-10,14H2 |
| InChIKey | LLZYSLJTYXECJV-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.74 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|