C22H17Cl3O2 — CID 2784853
(2,4,6-trichlorophenyl) 2-benzyl-3-phenylpropanoate (PubChem CID 2784853) has the molecular formula C22H17Cl3O2 and a molecular weight of 419.74 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 2-benzyl-3-phenylpropanoate.
| Compound Name | (2,4,6-trichlorophenyl) 2-benzyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 2784853 |
| Molecular Formula | C22H17Cl3O2 |
| Molecular Weight | 419.74 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | (2,4,6-trichlorophenyl) 2-benzyl-3-phenylpropanoate |
| SMILES | O=C(Oc1c(Cl)cc(Cl)cc1Cl)C(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H17Cl3O2/c23-18-13-19(24)21(20(25)14-18)27-22(26)17(11-15-7-3-1-4-8-15)12-16-9-5-2-6-10-16/h1-10,13-14,17H,11-12H2 |
| InChIKey | DZMVJFLWECXAHU-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.74 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|