About 2-amino-3-phenylpropanoic acid;chlorobenzene
2-amino-3-phenylpropanoic acid;chlorobenzene (PubChem CID 174438338) has the molecular formula C15H16ClNO2
and a molecular weight of 277.75 g/mol. Its IUPAC name is 2-amino-3-phenylpropanoic acid;chlorobenzene.
Molecular Properties
| Compound Name | 2-amino-3-phenylpropanoic acid;chlorobenzene |
| PubChem CID | 174438338 |
| Molecular Formula | C15H16ClNO2 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-amino-3-phenylpropanoic acid;chlorobenzene |
| SMILES | Clc1ccccc1.NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C9H11NO2.C6H5Cl/c10-8(9(11)12)6-7-4-2-1-3-5-7;7-6-4-2-1-3-5-6/h1-5,8H,6,10H2,(H,11,12);1-5H |
| InChIKey | VWFYWFBBXJWHMA-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-3-phenylpropanoic acid;chlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-phenylpropanoic acid;chlorobenzene?
The IUPAC name of 2-amino-3-phenylpropanoic acid;chlorobenzene (CID 174438338) is 2-amino-3-phenylpropanoic acid;chlorobenzene.
What is the SMILES notation for 2-amino-3-phenylpropanoic acid;chlorobenzene?
The canonical SMILES for 2-amino-3-phenylpropanoic acid;chlorobenzene is Clc1ccccc1.NC(Cc1ccccc1)C(=O)O.
What is the InChIKey of 2-amino-3-phenylpropanoic acid;chlorobenzene?
The InChIKey is VWFYWFBBXJWHMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.C6H5Cl/c10-8(9(11)12)6-7-4-2-1-3-5-7;7-6-4-2-1-3-5-6/h1-5,8H,6,10H2,(H,11,12);1-5H.
What are the key properties of 2-amino-3-phenylpropanoic acid;chlorobenzene?
2-amino-3-phenylpropanoic acid;chlorobenzene has a molecular weight of 277.75 g/mol, XLogP of 2.98, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-phenylpropanoic acid;chlorobenzene is sourced from PubChem (CID 174438338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).