C20H8Cl6O4 — CID 54423741
bis(2,4,6-trichlorophenyl) benzene-1,2-dicarboxylate (PubChem CID 54423741) has the molecular formula C20H8Cl6O4 and a molecular weight of 525.00 g/mol. Its IUPAC name is bis(2,4,6-trichlorophenyl) benzene-1,2-dicarboxylate.
| Compound Name | bis(2,4,6-trichlorophenyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 54423741 |
| Molecular Formula | C20H8Cl6O4 |
| Molecular Weight | 525.00 g/mol |
| Exact Mass | 521.86 |
| IUPAC Name | bis(2,4,6-trichlorophenyl) benzene-1,2-dicarboxylate |
| SMILES | O=C(Oc1c(Cl)cc(Cl)cc1Cl)c1ccccc1C(=O)Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C20H8Cl6O4/c21-9-5-13(23)17(14(24)6-9)29-19(27)11-3-1-2-4-12(11)20(28)30-18-15(25)7-10(22)8-16(18)26/h1-8H |
| InChIKey | WCPJPSPJHQSXCB-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.00 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|