C21H12Cl5FN2O2 — CID 53433164
[2,4-dichloro-6-[2-(2,4,6-trichlorophenyl)ethanehydrazonoyl]phenyl] 2-fluorobenzoate (PubChem CID 53433164) has the molecular formula C21H12Cl5FN2O2 and a molecular weight of 520.60 g/mol. Its IUPAC name is [2,4-dichloro-6-[2-(2,4,6-trichlorophenyl)ethanehydrazonoyl]phenyl] 2-fluorobenzoate.
| Compound Name | [2,4-dichloro-6-[2-(2,4,6-trichlorophenyl)ethanehydrazonoyl]phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 53433164 |
| Molecular Formula | C21H12Cl5FN2O2 |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 517.93 |
| IUPAC Name | [2,4-dichloro-6-[2-(2,4,6-trichlorophenyl)ethanehydrazonoyl]phenyl] 2-fluorobenzoate |
| SMILES | NN=C(Cc1c(Cl)cc(Cl)cc1Cl)c1cc(Cl)cc(Cl)c1OC(=O)c1ccccc1F |
| InChI | InChI=1S/C21H12Cl5FN2O2/c22-10-5-14(19(29-28)9-13-15(24)6-11(23)7-16(13)25)20(17(26)8-10)31-21(30)12-3-1-2-4-18(12)27/h1-8H,9,28H2 |
| InChIKey | CJCVCLKWAARIKM-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|