C15H12Cl2FN2O2+ — CID 6340714
[1-amino-2-(2,4-dichlorophenyl)ethylidene]-(2-fluorobenzoyl)oxyazanium (PubChem CID 6340714) has the molecular formula C15H12Cl2FN2O2+ and a molecular weight of 342.18 g/mol. Its IUPAC name is [1-amino-2-(2,4-dichlorophenyl)ethylidene]-(2-fluorobenzoyl)oxyazanium.
| Compound Name | [1-amino-2-(2,4-dichlorophenyl)ethylidene]-(2-fluorobenzoyl)oxyazanium |
|---|---|
| PubChem CID | 6340714 |
| Molecular Formula | C15H12Cl2FN2O2+ |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | [1-amino-2-(2,4-dichlorophenyl)ethylidene]-(2-fluorobenzoyl)oxyazanium |
| SMILES | NC(Cc1ccc(Cl)cc1Cl)=[NH+]OC(=O)c1ccccc1F |
| InChI | InChI=1S/C15H11Cl2FN2O2/c16-10-6-5-9(12(17)8-10)7-14(19)20-22-15(21)11-3-1-2-4-13(11)18/h1-6,8H,7H2,(H2,19,20)/p+1 |
| InChIKey | YAQYUYOUMZCIBX-UHFFFAOYSA-O |
| XLogP | 1.88 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|