(2,4-dichloronaphthalen-1-yl) 2,4-difluorobenzoate

C17H8Cl2F2O2 — CID 91717057

IUPAC(2,4-dichloronaphthalen-1-yl) 2,4-difluorobenzoate
SMILESO=C(Oc1c(Cl)cc(Cl)c2ccccc12)c1ccc(F)cc1F
InChIInChI=1S/C17H8Cl2F2O2/c18-13-8-14(19)16(11-4-2-1-3-10(11)13)23-17(22)12-6-5-9(20)7-15(12)21/h1-8H
InChIKeyUIZXNHVVHSPFEG-UHFFFAOYSA-N
MW353.15 g/mol
LogP5.64
Rot. Bonds2

About (2,4-dichloronaphthalen-1-yl) 2,4-difluorobenzoate

(2,4-dichloronaphthalen-1-yl) 2,4-difluorobenzoate (PubChem CID 91717057) has the molecular formula C17H8Cl2F2O2 and a molecular weight of 353.15 g/mol. Its IUPAC name is (2,4-dichloronaphthalen-1-yl) 2,4-difluorobenzoate.

Molecular Properties

Compound Name(2,4-dichloronaphthalen-1-yl) 2,4-difluorobenzoate
PubChem CID91717057
Molecular FormulaC17H8Cl2F2O2
Molecular Weight353.15 g/mol
Exact Mass351.99
IUPAC Name(2,4-dichloronaphthalen-1-yl) 2,4-difluorobenzoate
SMILESO=C(Oc1c(Cl)cc(Cl)c2ccccc12)c1ccc(F)cc1F
InChIInChI=1S/C17H8Cl2F2O2/c18-13-8-14(19)16(11-4-2-1-3-10(11)13)23-17(22)12-6-5-9(20)7-15(12)21/h1-8H
InChIKeyUIZXNHVVHSPFEG-UHFFFAOYSA-N
XLogP5.64
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms23
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500353.15
LogP ≤ 55.64
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze (2,4-dichloronaphthalen-1-yl) 2,4-difluorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,4-dichloronaphthalen-1-yl) 2,4-difluorobenzoate?
The IUPAC name of (2,4-dichloronaphthalen-1-yl) 2,4-difluorobenzoate (CID 91717057) is (2,4-dichloronaphthalen-1-yl) 2,4-difluorobenzoate.
What is the SMILES notation for (2,4-dichloronaphthalen-1-yl) 2,4-difluorobenzoate?
The canonical SMILES for (2,4-dichloronaphthalen-1-yl) 2,4-difluorobenzoate is O=C(Oc1c(Cl)cc(Cl)c2ccccc12)c1ccc(F)cc1F.
What is the InChIKey of (2,4-dichloronaphthalen-1-yl) 2,4-difluorobenzoate?
The InChIKey is UIZXNHVVHSPFEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H8Cl2F2O2/c18-13-8-14(19)16(11-4-2-1-3-10(11)13)23-17(22)12-6-5-9(20)7-15(12)21/h1-8H.
What are the key properties of (2,4-dichloronaphthalen-1-yl) 2,4-difluorobenzoate?
(2,4-dichloronaphthalen-1-yl) 2,4-difluorobenzoate has a molecular weight of 353.15 g/mol, XLogP of 5.64, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichloronaphthalen-1-yl) 2,4-difluorobenzoate is sourced from PubChem (CID 91717057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).