C20H9Cl6NO4 — CID 156874353
bis(2,4,6-trichlorophenyl) 5-methylpyridine-2,4-dicarboxylate (PubChem CID 156874353) has the molecular formula C20H9Cl6NO4 and a molecular weight of 540.01 g/mol. Its IUPAC name is bis(2,4,6-trichlorophenyl) 5-methylpyridine-2,4-dicarboxylate.
| Compound Name | bis(2,4,6-trichlorophenyl) 5-methylpyridine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 156874353 |
| Molecular Formula | C20H9Cl6NO4 |
| Molecular Weight | 540.01 g/mol |
| Exact Mass | 536.87 |
| IUPAC Name | bis(2,4,6-trichlorophenyl) 5-methylpyridine-2,4-dicarboxylate |
| SMILES | Cc1cnc(C(=O)Oc2c(Cl)cc(Cl)cc2Cl)cc1C(=O)Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C20H9Cl6NO4/c1-8-7-27-16(20(29)31-18-14(25)4-10(22)5-15(18)26)6-11(8)19(28)30-17-12(23)2-9(21)3-13(17)24/h2-7H,1H3 |
| InChIKey | SVCISZDYAJTIKI-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.01 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|