About bis(3-hydroxyphenyl) decanedioate;bis(3-hydroxyphenyl) hexanedioate
bis(3-hydroxyphenyl) decanedioate;bis(3-hydroxyphenyl) hexanedioate (PubChem CID 66808075) has the molecular formula C40H44O12
and a molecular weight of 716.78 g/mol. Its IUPAC name is bis(3-hydroxyphenyl) decanedioate;bis(3-hydroxyphenyl) hexanedioate.
Molecular Properties
| Compound Name | bis(3-hydroxyphenyl) decanedioate;bis(3-hydroxyphenyl) hexanedioate |
| PubChem CID | 66808075 |
| Molecular Formula | C40H44O12 |
| Molecular Weight | 716.78 g/mol |
| Exact Mass | 716.28 |
| IUPAC Name | bis(3-hydroxyphenyl) decanedioate;bis(3-hydroxyphenyl) hexanedioate |
| SMILES | O=C(CCCCC(=O)Oc1cccc(O)c1)Oc1cccc(O)c1.O=C(CCCCCCCCC(=O)Oc1cccc(O)c1)Oc1cccc(O)c1 |
| InChI | InChI=1S/C22H26O6.C18H18O6/c23-17-9-7-11-19(15-17)27-21(25)13-5-3-1-2-4-6-14-22(26)28-20-12-8-10-18(24)16-20;19-13-5-3-7-15(11-13)23-17(21)9-1-2-10-18(22)24-16-8-4-6-14(20)12-16/h7-12,15-16,23-24H,1-6,13-14H2;3-8,11-12,19-20H,1-2,9-10H2 |
| InChIKey | SBHXOBUIRRVVEV-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 716.78 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis(3-hydroxyphenyl) decanedioate;bis(3-hydroxyphenyl) hexanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-hydroxyphenyl) decanedioate;bis(3-hydroxyphenyl) hexanedioate?
The IUPAC name of bis(3-hydroxyphenyl) decanedioate;bis(3-hydroxyphenyl) hexanedioate (CID 66808075) is bis(3-hydroxyphenyl) decanedioate;bis(3-hydroxyphenyl) hexanedioate.
What is the SMILES notation for bis(3-hydroxyphenyl) decanedioate;bis(3-hydroxyphenyl) hexanedioate?
The canonical SMILES for bis(3-hydroxyphenyl) decanedioate;bis(3-hydroxyphenyl) hexanedioate is O=C(CCCCC(=O)Oc1cccc(O)c1)Oc1cccc(O)c1.O=C(CCCCCCCCC(=O)Oc1cccc(O)c1)Oc1cccc(O)c1.
What is the InChIKey of bis(3-hydroxyphenyl) decanedioate;bis(3-hydroxyphenyl) hexanedioate?
The InChIKey is SBHXOBUIRRVVEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26O6.C18H18O6/c23-17-9-7-11-19(15-17)27-21(25)13-5-3-1-2-4-6-14-22(26)28-20-12-8-10-18(24)16-20;19-13-5-3-7-15(11-13)23-17(21)9-1-2-10-18(22)24-16-8-4-6-14(20)12-16/h7-12,15-16,23-24H,1-6,13-14H2;3-8,11-12,19-20H,1-2,9-10H2.
What are the key properties of bis(3-hydroxyphenyl) decanedioate;bis(3-hydroxyphenyl) hexanedioate?
bis(3-hydroxyphenyl) decanedioate;bis(3-hydroxyphenyl) hexanedioate has a molecular weight of 716.78 g/mol, XLogP of 7.90, 18 rotatable bonds, 4 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-hydroxyphenyl) decanedioate;bis(3-hydroxyphenyl) hexanedioate is sourced from PubChem (CID 66808075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).