About bis(5-hydroxypentyl) carbonate;bis(3-hydroxyphenyl) carbonate;6-hydroxyhexyl 6-hydroxyhexanoate
bis(5-hydroxypentyl) carbonate;bis(3-hydroxyphenyl) carbonate;6-hydroxyhexyl 6-hydroxyhexanoate (PubChem CID 90713075) has the molecular formula C36H56O14
and a molecular weight of 712.83 g/mol. Its IUPAC name is bis(5-hydroxypentyl) carbonate;bis(3-hydroxyphenyl) carbonate;6-hydroxyhexyl 6-hydroxyhexanoate.
Molecular Properties
| Compound Name | bis(5-hydroxypentyl) carbonate;bis(3-hydroxyphenyl) carbonate;6-hydroxyhexyl 6-hydroxyhexanoate |
| PubChem CID | 90713075 |
| Molecular Formula | C36H56O14 |
| Molecular Weight | 712.83 g/mol |
| Exact Mass | 712.37 |
| IUPAC Name | bis(5-hydroxypentyl) carbonate;bis(3-hydroxyphenyl) carbonate;6-hydroxyhexyl 6-hydroxyhexanoate |
| SMILES | O=C(CCCCCO)OCCCCCCO.O=C(OCCCCCO)OCCCCCO.O=C(Oc1cccc(O)c1)Oc1cccc(O)c1 |
| InChI | InChI=1S/C13H10O5.C12H24O4.C11H22O5/c14-9-3-1-5-11(7-9)17-13(16)18-12-6-2-4-10(15)8-12;13-9-5-1-2-7-11-16-12(15)8-4-3-6-10-14;12-7-3-1-5-9-15-11(14)16-10-6-2-4-8-13/h1-8,14-15H;13-14H,1-11H2;12-13H,1-10H2 |
| InChIKey | GGHGJVHFUNZGGF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 218.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
4 violations
| Rule | Value |
| MW ≤ 500 | 712.83 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze bis(5-hydroxypentyl) carbonate;bis(3-hydroxyphenyl) carbonate;6-hydroxyhexyl 6-hydroxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5-hydroxypentyl) carbonate;bis(3-hydroxyphenyl) carbonate;6-hydroxyhexyl 6-hydroxyhexanoate?
The IUPAC name of bis(5-hydroxypentyl) carbonate;bis(3-hydroxyphenyl) carbonate;6-hydroxyhexyl 6-hydroxyhexanoate (CID 90713075) is bis(5-hydroxypentyl) carbonate;bis(3-hydroxyphenyl) carbonate;6-hydroxyhexyl 6-hydroxyhexanoate.
What is the SMILES notation for bis(5-hydroxypentyl) carbonate;bis(3-hydroxyphenyl) carbonate;6-hydroxyhexyl 6-hydroxyhexanoate?
The canonical SMILES for bis(5-hydroxypentyl) carbonate;bis(3-hydroxyphenyl) carbonate;6-hydroxyhexyl 6-hydroxyhexanoate is O=C(CCCCCO)OCCCCCCO.O=C(OCCCCCO)OCCCCCO.O=C(Oc1cccc(O)c1)Oc1cccc(O)c1.
What is the InChIKey of bis(5-hydroxypentyl) carbonate;bis(3-hydroxyphenyl) carbonate;6-hydroxyhexyl 6-hydroxyhexanoate?
The InChIKey is GGHGJVHFUNZGGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O5.C12H24O4.C11H22O5/c14-9-3-1-5-11(7-9)17-13(16)18-12-6-2-4-10(15)8-12;13-9-5-1-2-7-11-16-12(15)8-4-3-6-10-14;12-7-3-1-5-9-15-11(14)16-10-6-2-4-8-13/h1-8,14-15H;13-14H,1-11H2;12-13H,1-10H2.
What are the key properties of bis(5-hydroxypentyl) carbonate;bis(3-hydroxyphenyl) carbonate;6-hydroxyhexyl 6-hydroxyhexanoate?
bis(5-hydroxypentyl) carbonate;bis(3-hydroxyphenyl) carbonate;6-hydroxyhexyl 6-hydroxyhexanoate has a molecular weight of 712.83 g/mol, XLogP of 5.78, 23 rotatable bonds, 6 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5-hydroxypentyl) carbonate;bis(3-hydroxyphenyl) carbonate;6-hydroxyhexyl 6-hydroxyhexanoate is sourced from PubChem (CID 90713075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).