C18H18Cl2O5 — CID 2434345
(2,6-dichlorophenyl)methyl 2-(3,4,5-trimethoxyphenyl)acetate (PubChem CID 2434345) has the molecular formula C18H18Cl2O5 and a molecular weight of 385.24 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl 2-(3,4,5-trimethoxyphenyl)acetate.
| Compound Name | (2,6-dichlorophenyl)methyl 2-(3,4,5-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 2434345 |
| Molecular Formula | C18H18Cl2O5 |
| Molecular Weight | 385.24 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | (2,6-dichlorophenyl)methyl 2-(3,4,5-trimethoxyphenyl)acetate |
| SMILES | COc1cc(CC(=O)OCc2c(Cl)cccc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C18H18Cl2O5/c1-22-15-7-11(8-16(23-2)18(15)24-3)9-17(21)25-10-12-13(19)5-4-6-14(12)20/h4-8H,9-10H2,1-3H3 |
| InChIKey | QJIUNVDXQAPFGG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.24 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |