C22H22ClNO5S — CID 24683783
(2-chloro-7-methylsulfanylquinolin-3-yl)methyl 2-(3,4,5-trimethoxyphenyl)acetate (PubChem CID 24683783) has the molecular formula C22H22ClNO5S and a molecular weight of 447.94 g/mol. Its IUPAC name is (2-chloro-7-methylsulfanylquinolin-3-yl)methyl 2-(3,4,5-trimethoxyphenyl)acetate.
| Compound Name | (2-chloro-7-methylsulfanylquinolin-3-yl)methyl 2-(3,4,5-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 24683783 |
| Molecular Formula | C22H22ClNO5S |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | (2-chloro-7-methylsulfanylquinolin-3-yl)methyl 2-(3,4,5-trimethoxyphenyl)acetate |
| SMILES | COc1cc(CC(=O)OCc2cc3ccc(SC)cc3nc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C22H22ClNO5S/c1-26-18-7-13(8-19(27-2)21(18)28-3)9-20(25)29-12-15-10-14-5-6-16(30-4)11-17(14)24-22(15)23/h5-8,10-11H,9,12H2,1-4H3 |
| InChIKey | ZIOAFXKGKVBSLV-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|