C21H20ClNO3S — CID 7433833
(2-chloro-7-methylsulfanylquinolin-3-yl)methyl 3-(2-methylphenoxy)propanoate (PubChem CID 7433833) has the molecular formula C21H20ClNO3S and a molecular weight of 401.92 g/mol. Its IUPAC name is (2-chloro-7-methylsulfanylquinolin-3-yl)methyl 3-(2-methylphenoxy)propanoate.
| Compound Name | (2-chloro-7-methylsulfanylquinolin-3-yl)methyl 3-(2-methylphenoxy)propanoate |
|---|---|
| PubChem CID | 7433833 |
| Molecular Formula | C21H20ClNO3S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | (2-chloro-7-methylsulfanylquinolin-3-yl)methyl 3-(2-methylphenoxy)propanoate |
| SMILES | CSc1ccc2cc(COC(=O)CCOc3ccccc3C)c(Cl)nc2c1 |
| InChI | InChI=1S/C21H20ClNO3S/c1-14-5-3-4-6-19(14)25-10-9-20(24)26-13-16-11-15-7-8-17(27-2)12-18(15)23-21(16)22/h3-8,11-12H,9-10,13H2,1-2H3 |
| InChIKey | YLKFVBQJSROHIU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|