C20H18ClNO3S — CID 25499299
methyl 2-[4-[(2-chloro-7-methylsulfanylquinolin-3-yl)methoxy]phenyl]acetate (PubChem CID 25499299) has the molecular formula C20H18ClNO3S and a molecular weight of 387.89 g/mol. Its IUPAC name is methyl 2-[4-[(2-chloro-7-methylsulfanylquinolin-3-yl)methoxy]phenyl]acetate.
| Compound Name | methyl 2-[4-[(2-chloro-7-methylsulfanylquinolin-3-yl)methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 25499299 |
| Molecular Formula | C20H18ClNO3S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | methyl 2-[4-[(2-chloro-7-methylsulfanylquinolin-3-yl)methoxy]phenyl]acetate |
| SMILES | COC(=O)Cc1ccc(OCc2cc3ccc(SC)cc3nc2Cl)cc1 |
| InChI | InChI=1S/C20H18ClNO3S/c1-24-19(23)9-13-3-6-16(7-4-13)25-12-15-10-14-5-8-17(26-2)11-18(14)22-20(15)21/h3-8,10-11H,9,12H2,1-2H3 |
| InChIKey | LCJPKOAJVGIECO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|