C21H24ClN2O2S+ — CID 8676183
(2-chloro-7-methylsulfanylquinolin-3-yl)methyl-[(3,4-dimethoxyphenyl)methyl]-methylazanium (PubChem CID 8676183) has the molecular formula C21H24ClN2O2S+ and a molecular weight of 403.96 g/mol. Its IUPAC name is (2-chloro-7-methylsulfanylquinolin-3-yl)methyl-[(3,4-dimethoxyphenyl)methyl]-methylazanium.
| Compound Name | (2-chloro-7-methylsulfanylquinolin-3-yl)methyl-[(3,4-dimethoxyphenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8676183 |
| Molecular Formula | C21H24ClN2O2S+ |
| Molecular Weight | 403.96 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | (2-chloro-7-methylsulfanylquinolin-3-yl)methyl-[(3,4-dimethoxyphenyl)methyl]-methylazanium |
| SMILES | COc1ccc(C[NH+](C)Cc2cc3ccc(SC)cc3nc2Cl)cc1OC |
| InChI | InChI=1S/C21H23ClN2O2S/c1-24(12-14-5-8-19(25-2)20(9-14)26-3)13-16-10-15-6-7-17(27-4)11-18(15)23-21(16)22/h5-11H,12-13H2,1-4H3/p+1 |
| InChIKey | VUUZYZVSQHZOGW-UHFFFAOYSA-O |
| XLogP | 3.84 |
| TPSA | 35.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.96 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|