C17H23ClN3OS+ — CID 8710958
(2-chloro-7-methylsulfanylquinolin-3-yl)methyl-ethyl-[2-(ethylamino)-2-oxoethyl]azanium (PubChem CID 8710958) has the molecular formula C17H23ClN3OS+ and a molecular weight of 352.91 g/mol. Its IUPAC name is (2-chloro-7-methylsulfanylquinolin-3-yl)methyl-ethyl-[2-(ethylamino)-2-oxoethyl]azanium.
| Compound Name | (2-chloro-7-methylsulfanylquinolin-3-yl)methyl-ethyl-[2-(ethylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8710958 |
| Molecular Formula | C17H23ClN3OS+ |
| Molecular Weight | 352.91 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | (2-chloro-7-methylsulfanylquinolin-3-yl)methyl-ethyl-[2-(ethylamino)-2-oxoethyl]azanium |
| SMILES | CCNC(=O)C[NH+](CC)Cc1cc2ccc(SC)cc2nc1Cl |
| InChI | InChI=1S/C17H22ClN3OS/c1-4-19-16(22)11-21(5-2)10-13-8-12-6-7-14(23-3)9-15(12)20-17(13)18/h6-9H,4-5,10-11H2,1-3H3,(H,19,22)/p+1 |
| InChIKey | VHYPFLZCVPHKLH-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.91 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|