C20H23ClN3OS2+ — CID 8557099
(2-chloro-7-methylsulfanylquinolin-3-yl)methyl-ethyl-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]azanium (PubChem CID 8557099) has the molecular formula C20H23ClN3OS2+ and a molecular weight of 421.01 g/mol. Its IUPAC name is (2-chloro-7-methylsulfanylquinolin-3-yl)methyl-ethyl-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]azanium.
| Compound Name | (2-chloro-7-methylsulfanylquinolin-3-yl)methyl-ethyl-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]azanium |
|---|---|
| PubChem CID | 8557099 |
| Molecular Formula | C20H23ClN3OS2+ |
| Molecular Weight | 421.01 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | (2-chloro-7-methylsulfanylquinolin-3-yl)methyl-ethyl-[2-oxo-2-(thiophen-2-ylmethylamino)ethyl]azanium |
| SMILES | CC[NH+](CC(=O)NCc1cccs1)Cc1cc2ccc(SC)cc2nc1Cl |
| InChI | InChI=1S/C20H22ClN3OS2/c1-3-24(13-19(25)22-11-17-5-4-8-27-17)12-15-9-14-6-7-16(26-2)10-18(14)23-20(15)21/h4-10H,3,11-13H2,1-2H3,(H,22,25)/p+1 |
| InChIKey | DLQWDPHIINYULX-UHFFFAOYSA-O |
| XLogP | 3.39 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.01 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|