C17H21ClN3OS+ — CID 9053715
(2-chloro-7-methylsulfanylquinolin-3-yl)methyl-[2-(cyclopropylamino)-2-oxoethyl]-methylazanium (PubChem CID 9053715) has the molecular formula C17H21ClN3OS+ and a molecular weight of 350.90 g/mol. Its IUPAC name is (2-chloro-7-methylsulfanylquinolin-3-yl)methyl-[2-(cyclopropylamino)-2-oxoethyl]-methylazanium.
| Compound Name | (2-chloro-7-methylsulfanylquinolin-3-yl)methyl-[2-(cyclopropylamino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9053715 |
| Molecular Formula | C17H21ClN3OS+ |
| Molecular Weight | 350.90 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | (2-chloro-7-methylsulfanylquinolin-3-yl)methyl-[2-(cyclopropylamino)-2-oxoethyl]-methylazanium |
| SMILES | CSc1ccc2cc(C[NH+](C)CC(=O)NC3CC3)c(Cl)nc2c1 |
| InChI | InChI=1S/C17H20ClN3OS/c1-21(10-16(22)19-13-4-5-13)9-12-7-11-3-6-14(23-2)8-15(11)20-17(12)18/h3,6-8,13H,4-5,9-10H2,1-2H3,(H,19,22)/p+1 |
| InChIKey | FPOAPYLTGGQJQI-UHFFFAOYSA-O |
| XLogP | 1.90 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.90 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|