C19H18Cl2N3O+ — CID 9348112
[2-(4-chloroanilino)-2-oxoethyl]-[(2-chloroquinolin-3-yl)methyl]-methylazanium (PubChem CID 9348112) has the molecular formula C19H18Cl2N3O+ and a molecular weight of 375.28 g/mol. Its IUPAC name is [2-(4-chloroanilino)-2-oxoethyl]-[(2-chloroquinolin-3-yl)methyl]-methylazanium.
| Compound Name | [2-(4-chloroanilino)-2-oxoethyl]-[(2-chloroquinolin-3-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 9348112 |
| Molecular Formula | C19H18Cl2N3O+ |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | [2-(4-chloroanilino)-2-oxoethyl]-[(2-chloroquinolin-3-yl)methyl]-methylazanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(Cl)cc1)Cc1cc2ccccc2nc1Cl |
| InChI | InChI=1S/C19H17Cl2N3O/c1-24(12-18(25)22-16-8-6-15(20)7-9-16)11-14-10-13-4-2-3-5-17(13)23-19(14)21/h2-10H,11-12H2,1H3,(H,22,25)/p+1 |
| InChIKey | SFHYMXOMCTUJRR-UHFFFAOYSA-O |
| XLogP | 3.19 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|