C17H23ClN3O+ — CID 8767990
[2-(tert-butylamino)-2-oxoethyl]-[(2-chloroquinolin-3-yl)methyl]-methylazanium (PubChem CID 8767990) has the molecular formula C17H23ClN3O+ and a molecular weight of 320.84 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl]-[(2-chloroquinolin-3-yl)methyl]-methylazanium.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl]-[(2-chloroquinolin-3-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 8767990 |
| Molecular Formula | C17H23ClN3O+ |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl]-[(2-chloroquinolin-3-yl)methyl]-methylazanium |
| SMILES | C[NH+](CC(=O)NC(C)(C)C)Cc1cc2ccccc2nc1Cl |
| InChI | InChI=1S/C17H22ClN3O/c1-17(2,3)20-15(22)11-21(4)10-13-9-12-7-5-6-8-14(12)19-16(13)18/h5-9H,10-11H2,1-4H3,(H,20,22)/p+1 |
| InChIKey | CGVISOIHPQCZJV-UHFFFAOYSA-O |
| XLogP | 1.82 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|