C21H23ClN3O2S+ — CID 8710110
(2-chloro-7-methylsulfanylquinolin-3-yl)methyl-[2-(3-methoxyanilino)-2-oxoethyl]-methylazanium (PubChem CID 8710110) has the molecular formula C21H23ClN3O2S+ and a molecular weight of 416.95 g/mol. Its IUPAC name is (2-chloro-7-methylsulfanylquinolin-3-yl)methyl-[2-(3-methoxyanilino)-2-oxoethyl]-methylazanium.
| Compound Name | (2-chloro-7-methylsulfanylquinolin-3-yl)methyl-[2-(3-methoxyanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8710110 |
| Molecular Formula | C21H23ClN3O2S+ |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | (2-chloro-7-methylsulfanylquinolin-3-yl)methyl-[2-(3-methoxyanilino)-2-oxoethyl]-methylazanium |
| SMILES | COc1cccc(NC(=O)C[NH+](C)Cc2cc3ccc(SC)cc3nc2Cl)c1 |
| InChI | InChI=1S/C21H22ClN3O2S/c1-25(13-20(26)23-16-5-4-6-17(10-16)27-2)12-15-9-14-7-8-18(28-3)11-19(14)24-21(15)22/h4-11H,12-13H2,1-3H3,(H,23,26)/p+1 |
| InChIKey | BSXPPTBKBUCHKS-UHFFFAOYSA-O |
| XLogP | 3.27 |
| TPSA | 55.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|