C20H26N3O3S+ — CID 8556603
[2-(3-methoxyanilino)-2-oxoethyl]-methyl-[2-oxo-2-(2-phenylsulfanylethylamino)ethyl]azanium (PubChem CID 8556603) has the molecular formula C20H26N3O3S+ and a molecular weight of 388.51 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxoethyl]-methyl-[2-oxo-2-(2-phenylsulfanylethylamino)ethyl]azanium.
| Compound Name | [2-(3-methoxyanilino)-2-oxoethyl]-methyl-[2-oxo-2-(2-phenylsulfanylethylamino)ethyl]azanium |
|---|---|
| PubChem CID | 8556603 |
| Molecular Formula | C20H26N3O3S+ |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxoethyl]-methyl-[2-oxo-2-(2-phenylsulfanylethylamino)ethyl]azanium |
| SMILES | COc1cccc(NC(=O)C[NH+](C)CC(=O)NCCSc2ccccc2)c1 |
| InChI | InChI=1S/C20H25N3O3S/c1-23(15-20(25)22-16-7-6-8-17(13-16)26-2)14-19(24)21-11-12-27-18-9-4-3-5-10-18/h3-10,13H,11-12,14-15H2,1-2H3,(H,21,24)(H,22,25)/p+1 |
| InChIKey | XRBBKXBFRWTWNT-UHFFFAOYSA-O |
| XLogP | 1.06 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|