C18H23N2O3+ — CID 9248212
[(2S)-2-hydroxy-2-phenylethyl]-[2-(3-methoxyanilino)-2-oxoethyl]-methylazanium (PubChem CID 9248212) has the molecular formula C18H23N2O3+ and a molecular weight of 315.39 g/mol. Its IUPAC name is [(2S)-2-hydroxy-2-phenylethyl]-[2-(3-methoxyanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [(2S)-2-hydroxy-2-phenylethyl]-[2-(3-methoxyanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9248212 |
| Molecular Formula | C18H23N2O3+ |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | [(2S)-2-hydroxy-2-phenylethyl]-[2-(3-methoxyanilino)-2-oxoethyl]-methylazanium |
| SMILES | COc1cccc(NC(=O)C[NH+](C)C[C@@H](O)c2ccccc2)c1 |
| InChI | InChI=1S/C18H22N2O3/c1-20(12-17(21)14-7-4-3-5-8-14)13-18(22)19-15-9-6-10-16(11-15)23-2/h3-11,17,21H,12-13H2,1-2H3,(H,19,22)/p+1/t17-/m1/s1 |
| InChIKey | HNGRIHAXQBPXMK-QGZVFWFLSA-O |
| XLogP | 0.88 |
| TPSA | 63.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |