C18H26N3O3+ — CID 8554899
[2-[bis(prop-2-enyl)amino]-2-oxoethyl]-[2-(3-methoxyanilino)-2-oxoethyl]-methylazanium (PubChem CID 8554899) has the molecular formula C18H26N3O3+ and a molecular weight of 332.42 g/mol. Its IUPAC name is [2-[bis(prop-2-enyl)amino]-2-oxoethyl]-[2-(3-methoxyanilino)-2-oxoethyl]-methylazanium.
| Compound Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl]-[2-(3-methoxyanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8554899 |
| Molecular Formula | C18H26N3O3+ |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl]-[2-(3-methoxyanilino)-2-oxoethyl]-methylazanium |
| SMILES | C=CCN(CC=C)C(=O)C[NH+](C)CC(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C18H25N3O3/c1-5-10-21(11-6-2)18(23)14-20(3)13-17(22)19-15-8-7-9-16(12-15)24-4/h5-9,12H,1-2,10-11,13-14H2,3-4H3,(H,19,22)/p+1 |
| InChIKey | NFBGLLOGBAUKQD-UHFFFAOYSA-O |
| XLogP | 0.35 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|