C19H23N4O5+ — CID 2114294
[2-(3-methoxyanilino)-2-oxoethyl]-methyl-[2-(4-methyl-3-nitroanilino)-2-oxoethyl]azanium (PubChem CID 2114294) has the molecular formula C19H23N4O5+ and a molecular weight of 387.42 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxoethyl]-methyl-[2-(4-methyl-3-nitroanilino)-2-oxoethyl]azanium.
| Compound Name | [2-(3-methoxyanilino)-2-oxoethyl]-methyl-[2-(4-methyl-3-nitroanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 2114294 |
| Molecular Formula | C19H23N4O5+ |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxoethyl]-methyl-[2-(4-methyl-3-nitroanilino)-2-oxoethyl]azanium |
| SMILES | COc1cccc(NC(=O)C[NH+](C)CC(=O)Nc2ccc(C)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C19H22N4O5/c1-13-7-8-15(10-17(13)23(26)27)21-19(25)12-22(2)11-18(24)20-14-5-4-6-16(9-14)28-3/h4-10H,11-12H2,1-3H3,(H,20,24)(H,21,25)/p+1 |
| InChIKey | BLHZUUMWUAMCFH-UHFFFAOYSA-O |
| XLogP | 1.00 |
| TPSA | 115.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|