C15H19N2O2S+ — CID 8965326
[2-(3-methoxyanilino)-2-oxoethyl]-methyl-(thiophen-2-ylmethyl)azanium (PubChem CID 8965326) has the molecular formula C15H19N2O2S+ and a molecular weight of 291.40 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxoethyl]-methyl-(thiophen-2-ylmethyl)azanium.
| Compound Name | [2-(3-methoxyanilino)-2-oxoethyl]-methyl-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8965326 |
| Molecular Formula | C15H19N2O2S+ |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxoethyl]-methyl-(thiophen-2-ylmethyl)azanium |
| SMILES | COc1cccc(NC(=O)C[NH+](C)Cc2cccs2)c1 |
| InChI | InChI=1S/C15H18N2O2S/c1-17(10-14-7-4-8-20-14)11-15(18)16-12-5-3-6-13(9-12)19-2/h3-9H,10-11H2,1-2H3,(H,16,18)/p+1 |
| InChIKey | PWZOIZGVOPIDAX-UHFFFAOYSA-O |
| XLogP | 1.41 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |