C17H19ClFN2O2+ — CID 9197236
(2-chloro-6-fluorophenyl)methyl-[2-(3-methoxyanilino)-2-oxoethyl]-methylazanium (PubChem CID 9197236) has the molecular formula C17H19ClFN2O2+ and a molecular weight of 337.80 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl-[2-(3-methoxyanilino)-2-oxoethyl]-methylazanium.
| Compound Name | (2-chloro-6-fluorophenyl)methyl-[2-(3-methoxyanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9197236 |
| Molecular Formula | C17H19ClFN2O2+ |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl-[2-(3-methoxyanilino)-2-oxoethyl]-methylazanium |
| SMILES | COc1cccc(NC(=O)C[NH+](C)Cc2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C17H18ClFN2O2/c1-21(10-14-15(18)7-4-8-16(14)19)11-17(22)20-12-5-3-6-13(9-12)23-2/h3-9H,10-11H2,1-2H3,(H,20,22)/p+1 |
| InChIKey | GJCGAECKTHUBHN-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |