C16H16ClFN3O3+ — CID 9197353
(2-chloro-6-fluorophenyl)methyl-methyl-[2-(4-nitroanilino)-2-oxoethyl]azanium (PubChem CID 9197353) has the molecular formula C16H16ClFN3O3+ and a molecular weight of 352.77 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl-methyl-[2-(4-nitroanilino)-2-oxoethyl]azanium.
| Compound Name | (2-chloro-6-fluorophenyl)methyl-methyl-[2-(4-nitroanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9197353 |
| Molecular Formula | C16H16ClFN3O3+ |
| Molecular Weight | 352.77 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl-methyl-[2-(4-nitroanilino)-2-oxoethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccc([N+](=O)[O-])cc1)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C16H15ClFN3O3/c1-20(9-13-14(17)3-2-4-15(13)18)10-16(22)19-11-5-7-12(8-6-11)21(23)24/h2-8H,9-10H2,1H3,(H,19,22)/p+1 |
| InChIKey | ZLNDGOWOLOIADW-UHFFFAOYSA-O |
| XLogP | 2.04 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.77 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|