C16H18ClFN3O3S+ — CID 9197414
(2-chloro-6-fluorophenyl)methyl-methyl-[2-oxo-2-(3-sulfamoylanilino)ethyl]azanium (PubChem CID 9197414) has the molecular formula C16H18ClFN3O3S+ and a molecular weight of 386.86 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl-methyl-[2-oxo-2-(3-sulfamoylanilino)ethyl]azanium.
| Compound Name | (2-chloro-6-fluorophenyl)methyl-methyl-[2-oxo-2-(3-sulfamoylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 9197414 |
| Molecular Formula | C16H18ClFN3O3S+ |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl-methyl-[2-oxo-2-(3-sulfamoylanilino)ethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1cccc(S(N)(=O)=O)c1)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C16H17ClFN3O3S/c1-21(9-13-14(17)6-3-7-15(13)18)10-16(22)20-11-4-2-5-12(8-11)25(19,23)24/h2-8H,9-10H2,1H3,(H,20,22)(H2,19,23,24)/p+1 |
| InChIKey | YSPUWPUXGAEJOS-UHFFFAOYSA-O |
| XLogP | 0.78 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |