C18H24N3O4S+ — CID 8805412
(2-methoxy-5-methylphenyl)methyl-methyl-[2-oxo-2-(3-sulfamoylanilino)ethyl]azanium (PubChem CID 8805412) has the molecular formula C18H24N3O4S+ and a molecular weight of 378.47 g/mol. Its IUPAC name is (2-methoxy-5-methylphenyl)methyl-methyl-[2-oxo-2-(3-sulfamoylanilino)ethyl]azanium.
| Compound Name | (2-methoxy-5-methylphenyl)methyl-methyl-[2-oxo-2-(3-sulfamoylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 8805412 |
| Molecular Formula | C18H24N3O4S+ |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | (2-methoxy-5-methylphenyl)methyl-methyl-[2-oxo-2-(3-sulfamoylanilino)ethyl]azanium |
| SMILES | COc1ccc(C)cc1C[NH+](C)CC(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C18H23N3O4S/c1-13-7-8-17(25-3)14(9-13)11-21(2)12-18(22)20-15-5-4-6-16(10-15)26(19,23)24/h4-10H,11-12H2,1-3H3,(H,20,22)(H2,19,23,24)/p+1 |
| InChIKey | QUSKVGAAIRHKKH-UHFFFAOYSA-O |
| XLogP | 0.30 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |