C15H21N2O2+ — CID 8805826
(2-methoxy-5-methylphenyl)methyl-methyl-[2-oxo-2-(prop-2-ynylamino)ethyl]azanium (PubChem CID 8805826) has the molecular formula C15H21N2O2+ and a molecular weight of 261.34 g/mol. Its IUPAC name is (2-methoxy-5-methylphenyl)methyl-methyl-[2-oxo-2-(prop-2-ynylamino)ethyl]azanium.
| Compound Name | (2-methoxy-5-methylphenyl)methyl-methyl-[2-oxo-2-(prop-2-ynylamino)ethyl]azanium |
|---|---|
| PubChem CID | 8805826 |
| Molecular Formula | C15H21N2O2+ |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | (2-methoxy-5-methylphenyl)methyl-methyl-[2-oxo-2-(prop-2-ynylamino)ethyl]azanium |
| SMILES | C#CCNC(=O)C[NH+](C)Cc1cc(C)ccc1OC |
| InChI | InChI=1S/C15H20N2O2/c1-5-8-16-15(18)11-17(3)10-13-9-12(2)6-7-14(13)19-4/h1,6-7,9H,8,10-11H2,2-4H3,(H,16,18)/p+1 |
| InChIKey | UVHFUFASFNBKFF-UHFFFAOYSA-O |
| XLogP | -0.23 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|