C19H24BrN2O3+ — CID 9103940
(5-bromo-2-methoxyphenyl)methyl-[2-(2-methoxy-5-methylanilino)-2-oxoethyl]-methylazanium (PubChem CID 9103940) has the molecular formula C19H24BrN2O3+ and a molecular weight of 408.32 g/mol. Its IUPAC name is (5-bromo-2-methoxyphenyl)methyl-[2-(2-methoxy-5-methylanilino)-2-oxoethyl]-methylazanium.
| Compound Name | (5-bromo-2-methoxyphenyl)methyl-[2-(2-methoxy-5-methylanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9103940 |
| Molecular Formula | C19H24BrN2O3+ |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | (5-bromo-2-methoxyphenyl)methyl-[2-(2-methoxy-5-methylanilino)-2-oxoethyl]-methylazanium |
| SMILES | COc1ccc(Br)cc1C[NH+](C)CC(=O)Nc1cc(C)ccc1OC |
| InChI | InChI=1S/C19H23BrN2O3/c1-13-5-7-18(25-4)16(9-13)21-19(23)12-22(2)11-14-10-15(20)6-8-17(14)24-3/h5-10H,11-12H2,1-4H3,(H,21,23)/p+1 |
| InChIKey | YSQVOCCQAHOSPA-UHFFFAOYSA-O |
| XLogP | 2.43 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |