C15H24BrN2O2+ — CID 8810475
(5-bromo-2-methoxyphenyl)methyl-[2-(butylamino)-2-oxoethyl]-methylazanium (PubChem CID 8810475) has the molecular formula C15H24BrN2O2+ and a molecular weight of 344.27 g/mol. Its IUPAC name is (5-bromo-2-methoxyphenyl)methyl-[2-(butylamino)-2-oxoethyl]-methylazanium.
| Compound Name | (5-bromo-2-methoxyphenyl)methyl-[2-(butylamino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8810475 |
| Molecular Formula | C15H24BrN2O2+ |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (5-bromo-2-methoxyphenyl)methyl-[2-(butylamino)-2-oxoethyl]-methylazanium |
| SMILES | CCCCNC(=O)C[NH+](C)Cc1cc(Br)ccc1OC |
| InChI | InChI=1S/C15H23BrN2O2/c1-4-5-8-17-15(19)11-18(2)10-12-9-13(16)6-7-14(12)20-3/h6-7,9H,4-5,8,10-11H2,1-3H3,(H,17,19)/p+1 |
| InChIKey | AJOVSTATZOKDHB-UHFFFAOYSA-O |
| XLogP | 1.39 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|